C15H18Cl2O5 — CID 95346545
2-(2,4-dichlorophenoxy)ethyl (2R)-2-hydroxy-2-(oxan-4-yl)acetate (PubChem CID 95346545) has the molecular formula C15H18Cl2O5 and a molecular weight of 349.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl (2R)-2-hydroxy-2-(oxan-4-yl)acetate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl (2R)-2-hydroxy-2-(oxan-4-yl)acetate |
|---|---|
| PubChem CID | 95346545 |
| Molecular Formula | C15H18Cl2O5 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl (2R)-2-hydroxy-2-(oxan-4-yl)acetate |
| SMILES | O=C(OCCOc1ccc(Cl)cc1Cl)[C@H](O)C1CCOCC1 |
| InChI | InChI=1S/C15H18Cl2O5/c16-11-1-2-13(12(17)9-11)21-7-8-22-15(19)14(18)10-3-5-20-6-4-10/h1-2,9-10,14,18H,3-8H2/t14-/m1/s1 |
| InChIKey | JJUBFOJFCTXTKE-CQSZACIVSA-N |
| XLogP | 2.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|