About 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene
2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene (PubChem CID 96620806) has the molecular formula C8H10N2S2
and a molecular weight of 198.32 g/mol. Its IUPAC name is 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene.
Analyze 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene?
The IUPAC name of 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene (CID 96620806) is 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene.
What is the SMILES notation for 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene?
The canonical SMILES for 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene is c1sc2c3c1NCCN3CCS2.
What is the InChIKey of 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene?
The InChIKey is WIGJVCQUIPOWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S2/c1-2-10-3-4-11-8-7(10)6(9-1)5-12-8/h5,9H,1-4H2.
What are the key properties of 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene?
2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene has a molecular weight of 198.32 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,11-dithia-5,8-diazatricyclo[6.3.1.04,12]dodeca-1(12),3-diene is sourced from PubChem (CID 96620806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).