C11H12N2 — CID 96630858
8-methyl-1,2,3,6-tetrahydropyrrolo[2,3-e]indole (PubChem CID 96630858) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 8-methyl-1,2,3,6-tetrahydropyrrolo[2,3-e]indole.
| Compound Name | 8-methyl-1,2,3,6-tetrahydropyrrolo[2,3-e]indole |
|---|---|
| PubChem CID | 96630858 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 8-methyl-1,2,3,6-tetrahydropyrrolo[2,3-e]indole |
| SMILES | Cc1c[nH]c2ccc3c(c12)NCC3 |
| InChI | InChI=1S/C11H12N2/c1-7-6-13-9-3-2-8-4-5-12-11(8)10(7)9/h2-3,6,12-13H,4-5H2,1H3 |
| InChIKey | PKSDNMZNKZISPL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |