About (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate (PubChem CID 97014707) has the molecular formula C20H17ClN2O4
and a molecular weight of 384.82 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate.
Molecular Properties
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate |
| PubChem CID | 97014707 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate |
| SMILES | O=C(OCc1cc(Cl)cc2c1OCOC2)[C@@H](c1ccccc1)n1cccn1 |
| InChI | InChI=1S/C20H17ClN2O4/c21-17-9-15-11-25-13-27-19(15)16(10-17)12-26-20(24)18(23-8-4-7-22-23)14-5-2-1-3-6-14/h1-10,18H,11-13H2/t18-/m1/s1 |
| InChIKey | JQEQPRUTXSPTFW-GOSISDBHSA-N |
| XLogP | 3.74 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate?
The IUPAC name of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate (CID 97014707) is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate.
What is the SMILES notation for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate?
The canonical SMILES for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate is O=C(OCc1cc(Cl)cc2c1OCOC2)[C@@H](c1ccccc1)n1cccn1.
What is the InChIKey of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate?
The InChIKey is JQEQPRUTXSPTFW-GOSISDBHSA-N. The full InChI is InChI=1S/C20H17ClN2O4/c21-17-9-15-11-25-13-27-19(15)16(10-17)12-26-20(24)18(23-8-4-7-22-23)14-5-2-1-3-6-14/h1-10,18H,11-13H2/t18-/m1/s1.
What are the key properties of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate?
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate has a molecular weight of 384.82 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-phenyl-2-pyrazol-1-ylacetate is sourced from PubChem (CID 97014707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).