C31H30N4O5 — CID 98053175
(2R)-2-[(2,2-diphenylacetyl)amino]-3-methyl-N-[(E)-[4-(2-methyl-5-nitrophenyl)furan-3-yl]methylideneamino]butanamide (PubChem CID 98053175) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is (2R)-2-[(2,2-diphenylacetyl)amino]-3-methyl-N-[(E)-[4-(2-methyl-5-nitrophenyl)furan-3-yl]methylideneamino]butanamide.
| Compound Name | (2R)-2-[(2,2-diphenylacetyl)amino]-3-methyl-N-[(E)-[4-(2-methyl-5-nitrophenyl)furan-3-yl]methylideneamino]butanamide |
|---|---|
| PubChem CID | 98053175 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (2R)-2-[(2,2-diphenylacetyl)amino]-3-methyl-N-[(E)-[4-(2-methyl-5-nitrophenyl)furan-3-yl]methylideneamino]butanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1cocc1/C=N/NC(=O)[C@H](NC(=O)C(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C31H30N4O5/c1-20(2)29(33-30(36)28(22-10-6-4-7-11-22)23-12-8-5-9-13-23)31(37)34-32-17-24-18-40-19-27(24)26-16-25(35(38)39)15-14-21(26)3/h4-20,28-29H,1-3H3,(H,33,36)(H,34,37)/b32-17+/t29-/m1/s1 |
| InChIKey | HERUCOFYFAGMOX-NUDFWWKUSA-N |
| XLogP | 5.59 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|