C9H6N2O3 — CID 98095498
(3R)-2,4-dioxopyrido[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 98095498) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is (3R)-2,4-dioxopyrido[1,2-a]pyrimidine-3-carbaldehyde.
| Compound Name | (3R)-2,4-dioxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 98095498 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | (3R)-2,4-dioxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | O=C[C@@H]1C(=O)N=C2C=CC=CN2C1=O |
| InChI | InChI=1S/C9H6N2O3/c12-5-6-8(13)10-7-3-1-2-4-11(7)9(6)14/h1-6H/t6-/m1/s1 |
| InChIKey | GWMOMNJYLABQQH-ZCFIWIBFSA-N |
| XLogP | -0.35 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|