C7H7N3 — CID 172840238
2H-imidazo[1,2-a]pyridin-3-imine (PubChem CID 172840238) has the molecular formula C7H7N3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 2H-imidazo[1,2-a]pyridin-3-imine.
| Compound Name | 2H-imidazo[1,2-a]pyridin-3-imine |
|---|---|
| PubChem CID | 172840238 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 2H-imidazo[1,2-a]pyridin-3-imine |
| SMILES | [H]/N=C1\CN=C2C=CC=CN21 |
| InChI | InChI=1S/C7H7N3/c8-6-5-9-7-3-1-2-4-10(6)7/h1-4,8H,5H2/b8-6+ |
| InChIKey | WRSMLWYIESQXNU-SOFGYWHQSA-N |
| XLogP | 0.76 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|