C10H8N2OS — CID 70528787
5λ4-thia-1,8-diazatricyclo[7.4.0.02,6]trideca-2,6,8,10,12-pentaene 5-oxide (PubChem CID 70528787) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is 5λ4-thia-1,8-diazatricyclo[7.4.0.02,6]trideca-2,6,8,10,12-pentaene 5-oxide.
| Compound Name | 5λ4-thia-1,8-diazatricyclo[7.4.0.02,6]trideca-2,6,8,10,12-pentaene 5-oxide |
|---|---|
| PubChem CID | 70528787 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 5λ4-thia-1,8-diazatricyclo[7.4.0.02,6]trideca-2,6,8,10,12-pentaene 5-oxide |
| SMILES | O=S1CC=C2C1=CN=C1C=CC=CN21 |
| InChI | InChI=1S/C10H8N2OS/c13-14-6-4-8-9(14)7-11-10-3-1-2-5-12(8)10/h1-5,7H,6H2 |
| InChIKey | FYNQAWIUWPLYAM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |