C20H30N4O3S — CID 98336427
7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2,1,3-benzoxadiazole (PubChem CID 98336427) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2,1,3-benzoxadiazole.
| Compound Name | 7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 98336427 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2,1,3-benzoxadiazole |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ccc(S(=O)(=O)N3C[C@@H](C)C[C@H](C)C3)c3nonc23)C1 |
| InChI | InChI=1S/C20H30N4O3S/c1-13-7-14(2)10-23(9-13)17-5-6-18(20-19(17)21-27-22-20)28(25,26)24-11-15(3)8-16(4)12-24/h5-6,13-16H,7-12H2,1-4H3/t13-,14+,15-,16-/m0/s1 |
| InChIKey | GOAMGRZOIONLKP-FZKCQIBNSA-N |
| XLogP | 3.37 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |