C20H26N4O2 — CID 98781072
(3aR,4R,6aS)-N-(2-methylpropyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide (PubChem CID 98781072) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3aR,4R,6aS)-N-(2-methylpropyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide.
| Compound Name | (3aR,4R,6aS)-N-(2-methylpropyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide |
|---|---|
| PubChem CID | 98781072 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3aR,4R,6aS)-N-(2-methylpropyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide |
| SMILES | CC(C)CNC(=O)N1C[C@H]2CC[C@@]3(N=C(c4ccccc4)NC3=O)[C@H]2C1 |
| InChI | InChI=1S/C20H26N4O2/c1-13(2)10-21-19(26)24-11-15-8-9-20(16(15)12-24)18(25)22-17(23-20)14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3,(H,21,26)(H,22,23,25)/t15-,16+,20-/m1/s1 |
| InChIKey | GLMLZHGCXGCKGY-GQIGUUNPSA-N |
| XLogP | 2.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |