C17H10Cl2FN3O2 — CID 99822385
2,4-dichloro-5-fluoro-N-[6-(4-oxo-1-pyridinyl)-3-pyridinyl]benzamide (PubChem CID 99822385) has the molecular formula C17H10Cl2FN3O2 and a molecular weight of 378.19 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[6-(4-oxo-1-pyridinyl)-3-pyridinyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[6-(4-oxo-1-pyridinyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 99822385 |
| Molecular Formula | C17H10Cl2FN3O2 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[6-(4-oxo-1-pyridinyl)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(-n2ccc(=O)cc2)nc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl2FN3O2/c18-13-8-14(19)15(20)7-12(13)17(25)22-10-1-2-16(21-9-10)23-5-3-11(24)4-6-23/h1-9H,(H,22,25) |
| InChIKey | LQPJPQITRVGZNF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|