About benzamide
benzamide (PubChem CID 2331) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is benzamide.
Molecular Properties
| Compound Name | benzamide |
| PubChem CID | 2331 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | benzamide |
| SMILES | NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| InChIKey | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide?
The IUPAC name of benzamide (CID 2331) is benzamide.
What is the SMILES notation for benzamide?
The canonical SMILES for benzamide is NC(=O)c1ccccc1.
What is the InChIKey of benzamide?
The InChIKey is KXDAEFPNCMNJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9).
What are the key properties of benzamide?
benzamide has a molecular weight of 121.14 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide is sourced from PubChem (CID 2331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).