About lithium carbamate
lithium carbamate (PubChem CID 23703745) has the molecular formula CH2LiNO2
and a molecular weight of 66.97 g/mol. Its IUPAC name is lithium carbamate.
Molecular Properties
| Compound Name | lithium carbamate |
| PubChem CID | 23703745 |
| Molecular Formula | CH2LiNO2 |
| Molecular Weight | 66.97 g/mol |
| Exact Mass | 67.02 |
| IUPAC Name | lithium carbamate |
| SMILES | NC(=O)[O-].[Li+] |
| InChI | InChI=1S/CH3NO2.Li/c2-1(3)4;/h2H2,(H,3,4);/q;+1/p-1 |
| InChIKey | SKVWXDRVFXUPJX-UHFFFAOYSA-M |
| XLogP | -4.71 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 66.97 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium carbamate?
The IUPAC name of lithium carbamate (CID 23703745) is lithium carbamate.
What is the SMILES notation for lithium carbamate?
The canonical SMILES for lithium carbamate is NC(=O)[O-].[Li+].
What is the InChIKey of lithium carbamate?
The InChIKey is SKVWXDRVFXUPJX-UHFFFAOYSA-M. The full InChI is InChI=1S/CH3NO2.Li/c2-1(3)4;/h2H2,(H,3,4);/q;+1/p-1.
What are the key properties of lithium carbamate?
lithium carbamate has a molecular weight of 66.97 g/mol, XLogP of -4.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium carbamate is sourced from PubChem (CID 23703745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).