About N-tritylpentanamide
N-tritylpentanamide (PubChem CID 71163215) has the molecular formula C24H25NO
and a molecular weight of 343.47 g/mol. Its IUPAC name is N-tritylpentanamide.
Molecular Properties
| Compound Name | N-tritylpentanamide |
| PubChem CID | 71163215 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-tritylpentanamide |
| SMILES | CCCCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO/c1-2-3-19-23(26)25-24(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18H,2-3,19H2,1H3,(H,25,26) |
| InChIKey | NECWVUPIUGTEFZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-tritylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tritylpentanamide?
The IUPAC name of N-tritylpentanamide (CID 71163215) is N-tritylpentanamide.
What is the SMILES notation for N-tritylpentanamide?
The canonical SMILES for N-tritylpentanamide is CCCCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-tritylpentanamide?
The InChIKey is NECWVUPIUGTEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO/c1-2-3-19-23(26)25-24(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18H,2-3,19H2,1H3,(H,25,26).
What are the key properties of N-tritylpentanamide?
N-tritylpentanamide has a molecular weight of 343.47 g/mol, XLogP of 5.28, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tritylpentanamide is sourced from PubChem (CID 71163215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).