C29H27NO3S — CID 100955621
[4-[(1-sulfanylnaphthalen-2-yl)iminomethyl]phenyl] 4-pentoxybenzoate (PubChem CID 100955621) has the molecular formula C29H27NO3S and a molecular weight of 469.61 g/mol. Its IUPAC name is [4-[(1-sulfanylnaphthalen-2-yl)iminomethyl]phenyl] 4-pentoxybenzoate.
| Compound Name | [4-[(1-sulfanylnaphthalen-2-yl)iminomethyl]phenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 100955621 |
| Molecular Formula | C29H27NO3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [4-[(1-sulfanylnaphthalen-2-yl)iminomethyl]phenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccc4ccccc4c3S)cc2)cc1 |
| InChI | InChI=1S/C29H27NO3S/c1-2-3-6-19-32-24-16-11-23(12-17-24)29(31)33-25-14-9-21(10-15-25)20-30-27-18-13-22-7-4-5-8-26(22)28(27)34/h4-5,7-18,20,34H,2-3,6,19H2,1H3/b30-20+ |
| InChIKey | SESQISOFFOYUQC-TWKHWXDSSA-N |
| XLogP | 7.67 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|