C23H20BrNO3 — CID 101016329
[4-[(2-bromophenyl)iminomethyl]phenyl] 4-propoxybenzoate (PubChem CID 101016329) has the molecular formula C23H20BrNO3 and a molecular weight of 438.32 g/mol. Its IUPAC name is [4-[(2-bromophenyl)iminomethyl]phenyl] 4-propoxybenzoate.
| Compound Name | [4-[(2-bromophenyl)iminomethyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 101016329 |
| Molecular Formula | C23H20BrNO3 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | [4-[(2-bromophenyl)iminomethyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N/c3ccccc3Br)cc2)cc1 |
| InChI | InChI=1S/C23H20BrNO3/c1-2-15-27-19-13-9-18(10-14-19)23(26)28-20-11-7-17(8-12-20)16-25-22-6-4-3-5-21(22)24/h3-14,16H,2,15H2,1H3/b25-16+ |
| InChIKey | LLENYAXYQNYZSY-PCLIKHOPSA-N |
| XLogP | 6.21 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|