C10H11Cl3O2S — CID 101012415
(1S,4R)-5-methylidene-6-(trichloromethylsulfonyl)bicyclo[2.2.2]oct-2-ene (PubChem CID 101012415) has the molecular formula C10H11Cl3O2S and a molecular weight of 301.62 g/mol. Its IUPAC name is (1S,4R)-5-methylidene-6-(trichloromethylsulfonyl)bicyclo[2.2.2]oct-2-ene.
| Compound Name | (1S,4R)-5-methylidene-6-(trichloromethylsulfonyl)bicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 101012415 |
| Molecular Formula | C10H11Cl3O2S |
| Molecular Weight | 301.62 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | (1S,4R)-5-methylidene-6-(trichloromethylsulfonyl)bicyclo[2.2.2]oct-2-ene |
| SMILES | C=C1C(S(=O)(=O)C(Cl)(Cl)Cl)[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C10H11Cl3O2S/c1-6-7-2-4-8(5-3-7)9(6)16(14,15)10(11,12)13/h2,4,7-9H,1,3,5H2/t7-,8+,9?/m0/s1 |
| InChIKey | VHNHUFMXXKCXOV-ZQTLJVIJSA-N |
| XLogP | 3.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|