C33H42O4SSi — CID 101056844
[5-[(E)-2-(benzenesulfonyl)ethenoxy]-7,7-diphenylhept-6-enoxy]-tert-butyl-dimethylsilane (PubChem CID 101056844) has the molecular formula C33H42O4SSi and a molecular weight of 562.85 g/mol. Its IUPAC name is [5-[(E)-2-(benzenesulfonyl)ethenoxy]-7,7-diphenylhept-6-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [5-[(E)-2-(benzenesulfonyl)ethenoxy]-7,7-diphenylhept-6-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101056844 |
| Molecular Formula | C33H42O4SSi |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [5-[(E)-2-(benzenesulfonyl)ethenoxy]-7,7-diphenylhept-6-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC(C=C(c1ccccc1)c1ccccc1)O/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H42O4SSi/c1-33(2,3)39(4,5)37-24-16-15-21-30(36-25-26-38(34,35)31-22-13-8-14-23-31)27-32(28-17-9-6-10-18-28)29-19-11-7-12-20-29/h6-14,17-20,22-23,25-27,30H,15-16,21,24H2,1-5H3/b26-25+ |
| InChIKey | JGGWBZSBSBCPOE-OCEACIFDSA-N |
| XLogP | 8.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|