C25H33NO3S2 — CID 101085076
[(4S,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 101085076) has the molecular formula C25H33NO3S2 and a molecular weight of 459.68 g/mol. Its IUPAC name is [(4S,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(4S,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 101085076 |
| Molecular Formula | C25H33NO3S2 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [(4S,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](C)O1 |
| InChI | InChI=1S/C25H33NO3S2/c1-4-26(5-2)25(30)31-23-16-22(27-17-20-12-8-6-9-13-20)24(19(3)29-23)28-18-21-14-10-7-11-15-21/h6-15,19,22-24H,4-5,16-18H2,1-3H3/t19-,22-,23?,24-/m0/s1 |
| InChIKey | OCGCWLNIESIXRH-FYEORBFXSA-N |
| XLogP | 5.65 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|