C18H18N2O3 — CID 101139723
(3aR,4R,6aS)-4-(2,2-diphenylhydrazinyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (PubChem CID 101139723) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(2,2-diphenylhydrazinyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
| Compound Name | (3aR,4R,6aS)-4-(2,2-diphenylhydrazinyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 101139723 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (3aR,4R,6aS)-4-(2,2-diphenylhydrazinyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
| SMILES | O=C1O[C@@H]2OCC[C@@H]2[C@H]1NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c21-17-16(15-11-12-22-18(15)23-17)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16,18-19H,11-12H2/t15-,16-,18+/m1/s1 |
| InChIKey | YFXYBZXLHKIJGF-NUJGCVRESA-N |
| XLogP | 2.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|