C19H21N5 — CID 101148770
5-methyl-3-(prop-2-enylamino)-6-[(2,4,6-trimethylphenyl)iminomethyl]pyrazine-2-carbonitrile (PubChem CID 101148770) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-methyl-3-(prop-2-enylamino)-6-[(2,4,6-trimethylphenyl)iminomethyl]pyrazine-2-carbonitrile.
| Compound Name | 5-methyl-3-(prop-2-enylamino)-6-[(2,4,6-trimethylphenyl)iminomethyl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 101148770 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-methyl-3-(prop-2-enylamino)-6-[(2,4,6-trimethylphenyl)iminomethyl]pyrazine-2-carbonitrile |
| SMILES | C=CCNc1nc(C)c(/C=N/c2c(C)cc(C)cc2C)nc1C#N |
| InChI | InChI=1S/C19H21N5/c1-6-7-21-19-16(10-20)24-17(15(5)23-19)11-22-18-13(3)8-12(2)9-14(18)4/h6,8-9,11H,1,7H2,2-5H3,(H,21,23)/b22-11+ |
| InChIKey | IRWVLVDTCBPMMI-SSDVNMTOSA-N |
| XLogP | 3.93 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|