C25H28FN3O5 — CID 101150534
methyl (2S)-2-[[2-cyano-2-fluoro-2-(4-methylphenyl)acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 101150534) has the molecular formula C25H28FN3O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is methyl (2S)-2-[[2-cyano-2-fluoro-2-(4-methylphenyl)acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2-[[2-cyano-2-fluoro-2-(4-methylphenyl)acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 101150534 |
| Molecular Formula | C25H28FN3O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | methyl (2S)-2-[[2-cyano-2-fluoro-2-(4-methylphenyl)acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)C(F)(C#N)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28FN3O5/c1-18-11-13-20(14-12-18)25(26,17-27)23(31)29-21(22(30)33-2)10-6-7-15-28-24(32)34-16-19-8-4-3-5-9-19/h3-5,8-9,11-14,21H,6-7,10,15-16H2,1-2H3,(H,28,32)(H,29,31)/t21-,25?/m0/s1 |
| InChIKey | ZNPVULLIQSNASP-BWDMCYIDSA-N |
| XLogP | 3.44 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|