C18H26OSi — CID 101224152
[(Z)-[(2S,5R)-5-ethenyl-2-(2-phenylethyl)oxolan-3-ylidene]methyl]-trimethylsilane (PubChem CID 101224152) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is [(Z)-[(2S,5R)-5-ethenyl-2-(2-phenylethyl)oxolan-3-ylidene]methyl]-trimethylsilane.
| Compound Name | [(Z)-[(2S,5R)-5-ethenyl-2-(2-phenylethyl)oxolan-3-ylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 101224152 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [(Z)-[(2S,5R)-5-ethenyl-2-(2-phenylethyl)oxolan-3-ylidene]methyl]-trimethylsilane |
| SMILES | C=C[C@H]1C/C(=C/[Si](C)(C)C)[C@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C18H26OSi/c1-5-17-13-16(14-20(2,3)4)18(19-17)12-11-15-9-7-6-8-10-15/h5-10,14,17-18H,1,11-13H2,2-4H3/b16-14-/t17-,18-/m0/s1 |
| InChIKey | WRORZBYPXXGXNE-FCNQMZBHSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|