C13H10O — CID 101272198
cyclohexa-1,3,4-trien-1-yl(phenyl)methanone (PubChem CID 101272198) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is cyclohexa-1,3,4-trien-1-yl(phenyl)methanone.
| Compound Name | cyclohexa-1,3,4-trien-1-yl(phenyl)methanone |
|---|---|
| PubChem CID | 101272198 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | cyclohexa-1,3,4-trien-1-yl(phenyl)methanone |
| SMILES | O=C(C1=CC=C=CC1)c1ccccc1 |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-9H,10H2 |
| InChIKey | DKLZAMOMNNTTLS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |