C20H35F2N5O7P2 — CID 101272330
[(3R)-3-[diethoxyphosphoryl(difluoro)methyl]-5-[6-(methylamino)purin-9-yl]pentyl] diethyl phosphate (PubChem CID 101272330) has the molecular formula C20H35F2N5O7P2 and a molecular weight of 557.47 g/mol. Its IUPAC name is [(3R)-3-[diethoxyphosphoryl(difluoro)methyl]-5-[6-(methylamino)purin-9-yl]pentyl] diethyl phosphate.
| Compound Name | [(3R)-3-[diethoxyphosphoryl(difluoro)methyl]-5-[6-(methylamino)purin-9-yl]pentyl] diethyl phosphate |
|---|---|
| PubChem CID | 101272330 |
| Molecular Formula | C20H35F2N5O7P2 |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | [(3R)-3-[diethoxyphosphoryl(difluoro)methyl]-5-[6-(methylamino)purin-9-yl]pentyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC[C@@H](CCn1cnc2c(NC)ncnc21)C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H35F2N5O7P2/c1-6-30-35(28,31-7-2)20(21,22)16(11-13-34-36(29,32-8-3)33-9-4)10-12-27-15-26-17-18(23-5)24-14-25-19(17)27/h14-16H,6-13H2,1-5H3,(H,23,24,25)/t16-/m1/s1 |
| InChIKey | PLIQJIHIRPMYCU-MRXNPFEDSA-N |
| XLogP | 5.32 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|