C37H60O5Si2 — CID 101393378
(2R,4R,5S,6R,8S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-methyl-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undecan-5-ol (PubChem CID 101393378) has the molecular formula C37H60O5Si2 and a molecular weight of 641.05 g/mol. Its IUPAC name is (2R,4R,5S,6R,8S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-methyl-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undecan-5-ol.
| Compound Name | (2R,4R,5S,6R,8S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-methyl-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undecan-5-ol |
|---|---|
| PubChem CID | 101393378 |
| Molecular Formula | C37H60O5Si2 |
| Molecular Weight | 641.05 g/mol |
| Exact Mass | 640.40 |
| IUPAC Name | (2R,4R,5S,6R,8S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-methyl-4-tri(propan-2-yl)silyloxy-1,7-dioxaspiro[5.5]undecan-5-ol |
| SMILES | CC(C)[Si](O[C@@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@]2(CCC[C@H](C)O2)[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H60O5Si2/c1-27(2)43(28(3)4,29(5)6)42-34-26-31(41-37(35(34)38)24-17-18-30(7)40-37)23-25-39-44(36(8,9)10,32-19-13-11-14-20-32)33-21-15-12-16-22-33/h11-16,19-22,27-31,34-35,38H,17-18,23-26H2,1-10H3/t30-,31+,34+,35-,37+/m0/s1 |
| InChIKey | IVAQJYWAWQKNGT-PDLWCCODSA-N |
| XLogP | 7.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.05 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|