C26H44OSi — CID 101426483
[(1R,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101426483) has the molecular formula C26H44OSi and a molecular weight of 400.72 g/mol. Its IUPAC name is [(1R,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101426483 |
| Molecular Formula | C26H44OSi |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | [(1R,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | Cc1ccc2c(c1)[C@@]1(C)CCC[C@@](C)(O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CC2 |
| InChI | InChI=1S/C26H44OSi/c1-18(2)28(19(3)4,20(5)6)27-26(9)16-10-15-25(8)23-17-21(7)11-12-22(23)13-14-24(25)26/h11-12,17-20,24H,10,13-16H2,1-9H3/t24-,25-,26-/m1/s1 |
| InChIKey | GKGRWQJHQBFDHJ-TWJOJJKGSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|