C35H53N3O3 — CID 10144416
[4-methyl-1-[4-[4-[2-(2-methylpropyl)pyrrolidin-1-yl]butoxy]butyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10144416) has the molecular formula C35H53N3O3 and a molecular weight of 563.83 g/mol. Its IUPAC name is [4-methyl-1-[4-[4-[2-(2-methylpropyl)pyrrolidin-1-yl]butoxy]butyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [4-methyl-1-[4-[4-[2-(2-methylpropyl)pyrrolidin-1-yl]butoxy]butyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10144416 |
| Molecular Formula | C35H53N3O3 |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.41 |
| IUPAC Name | [4-methyl-1-[4-[4-[2-(2-methylpropyl)pyrrolidin-1-yl]butoxy]butyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CC(C)CC1CCCN1CCCCOCCCCN1CCC(C)(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C35H53N3O3/c1-29(2)28-31-16-13-23-38(31)22-10-12-27-40-26-11-9-21-37-24-19-35(3,20-25-37)41-34(39)36-33-18-8-7-17-32(33)30-14-5-4-6-15-30/h4-8,14-15,17-18,29,31H,9-13,16,19-28H2,1-3H3,(H,36,39) |
| InChIKey | RRTNNKMWIQVOGP-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|