C38H52N4O3 — CID 10438750
[1-[4-[4-[(2S)-2-(anilinomethyl)pyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10438750) has the molecular formula C38H52N4O3 and a molecular weight of 612.86 g/mol. Its IUPAC name is [1-[4-[4-[(2S)-2-(anilinomethyl)pyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[4-[4-[(2S)-2-(anilinomethyl)pyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10438750 |
| Molecular Formula | C38H52N4O3 |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.40 |
| IUPAC Name | [1-[4-[4-[(2S)-2-(anilinomethyl)pyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CC1(OC(=O)Nc2ccccc2-c2ccccc2)CCN(CCCCOCCCCN2CCC[C@H]2CNc2ccccc2)CC1 |
| InChI | InChI=1S/C38H52N4O3/c1-38(45-37(43)40-36-21-9-8-20-35(36)32-15-4-2-5-16-32)22-27-41(28-23-38)24-10-12-29-44-30-13-11-25-42-26-14-19-34(42)31-39-33-17-6-3-7-18-33/h2-9,15-18,20-21,34,39H,10-14,19,22-31H2,1H3,(H,40,43)/t34-/m0/s1 |
| InChIKey | MOCJSXWJQGDFOV-UMSFTDKQSA-N |
| XLogP | 7.91 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|