C39H54N4O2 — CID 10145598
[1-[8-[[(3S)-1-benzylpyrrolidin-3-yl]-methylamino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10145598) has the molecular formula C39H54N4O2 and a molecular weight of 610.89 g/mol. Its IUPAC name is [1-[8-[[(3S)-1-benzylpyrrolidin-3-yl]-methylamino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[8-[[(3S)-1-benzylpyrrolidin-3-yl]-methylamino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10145598 |
| Molecular Formula | C39H54N4O2 |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.42 |
| IUPAC Name | [1-[8-[[(3S)-1-benzylpyrrolidin-3-yl]-methylamino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCCCCCCCN1CCC(C)(OC(=O)Nc2ccccc2-c2ccccc2)CC1)[C@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C39H54N4O2/c1-39(45-38(44)40-37-22-14-13-21-36(37)34-19-11-8-12-20-34)24-29-42(30-25-39)27-16-6-4-3-5-15-26-41(2)35-23-28-43(32-35)31-33-17-9-7-10-18-33/h7-14,17-22,35H,3-6,15-16,23-32H2,1-2H3,(H,40,44)/t35-/m0/s1 |
| InChIKey | GRGBQQARXVNSSI-DHUJRADRSA-N |
| XLogP | 8.30 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|