C33H51N3O4 — CID 10280942
[1-[8-[bis(2-methoxyethyl)amino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10280942) has the molecular formula C33H51N3O4 and a molecular weight of 553.79 g/mol. Its IUPAC name is [1-[8-[bis(2-methoxyethyl)amino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[8-[bis(2-methoxyethyl)amino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10280942 |
| Molecular Formula | C33H51N3O4 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.39 |
| IUPAC Name | [1-[8-[bis(2-methoxyethyl)amino]octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | COCCN(CCCCCCCCN1CCC(C)(OC(=O)Nc2ccccc2-c2ccccc2)CC1)CCOC |
| InChI | InChI=1S/C33H51N3O4/c1-33(40-32(37)34-31-18-12-11-17-30(31)29-15-9-8-10-16-29)19-23-35(24-20-33)21-13-6-4-5-7-14-22-36(25-27-38-2)26-28-39-3/h8-12,15-18H,4-7,13-14,19-28H2,1-3H3,(H,34,37) |
| InChIKey | NVHUFSGVWXOGNV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|