C25H32Cl2N4O6S — CID 10145064
2-[[cyclohexyl(nitrososulfanyl)methyl]-methylamino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate;nitric acid (PubChem CID 10145064) has the molecular formula C25H32Cl2N4O6S and a molecular weight of 587.53 g/mol. Its IUPAC name is 2-[[cyclohexyl(nitrososulfanyl)methyl]-methylamino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate;nitric acid.
| Compound Name | 2-[[cyclohexyl(nitrososulfanyl)methyl]-methylamino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate;nitric acid |
|---|---|
| PubChem CID | 10145064 |
| Molecular Formula | C25H32Cl2N4O6S |
| Molecular Weight | 587.53 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 2-[[cyclohexyl(nitrososulfanyl)methyl]-methylamino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate;nitric acid |
| SMILES | CC(COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl)N(C)C(SN=O)C1CCCCC1.O=[N+]([O-])O |
| InChI | InChI=1S/C25H31Cl2N3O3S.HNO3/c1-17(30(2)25(34-29-32)18-9-4-3-5-10-18)16-33-23(31)15-19-11-6-7-14-22(19)28-24-20(26)12-8-13-21(24)27;2-1(3)4/h6-8,11-14,17-18,25,28H,3-5,9-10,15-16H2,1-2H3;(H,2,3,4) |
| InChIKey | LDFXFHOZQICHMB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|