C22H19BF10N- — CID 102136348
bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)boranuide (PubChem CID 102136348) has the molecular formula C22H19BF10N- and a molecular weight of 498.19 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)boranuide |
|---|---|
| PubChem CID | 102136348 |
| Molecular Formula | C22H19BF10N- |
| Molecular Weight | 498.19 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)boranuide |
| SMILES | Fc1c(F)c(F)c([BH-](c2c(F)c(F)c(F)c(F)c2F)C2CCCC2N2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C22H19BF10N/c24-13-11(14(25)18(29)21(32)17(13)28)23(12-15(26)19(30)22(33)20(31)16(12)27)9-5-4-6-10(9)34-7-2-1-3-8-34/h9-10,23H,1-8H2/q-1 |
| InChIKey | ZLTPIWYXJKXGIH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.19 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|