C30H33FN2OSi — CID 102158607
tert-butyl-[(2S)-2-[4-(4-fluorophenyl)imidazol-1-yl]pent-4-enoxy]-diphenylsilane (PubChem CID 102158607) has the molecular formula C30H33FN2OSi and a molecular weight of 484.69 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[4-(4-fluorophenyl)imidazol-1-yl]pent-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[4-(4-fluorophenyl)imidazol-1-yl]pent-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102158607 |
| Molecular Formula | C30H33FN2OSi |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | tert-butyl-[(2S)-2-[4-(4-fluorophenyl)imidazol-1-yl]pent-4-enoxy]-diphenylsilane |
| SMILES | C=CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)n1cnc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C30H33FN2OSi/c1-5-12-26(33-21-29(32-23-33)24-17-19-25(31)20-18-24)22-34-35(30(2,3)4,27-13-8-6-9-14-27)28-15-10-7-11-16-28/h5-11,13-21,23,26H,1,12,22H2,2-4H3/t26-/m0/s1 |
| InChIKey | MVYNWWDRYVRJMU-SANMLTNESA-N |
| XLogP | 6.38 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|