C18H11BrClNO2 — CID 102169245
1-(4-bromophenyl)-5-chloro-3-phenylpyrrole-2,4-dicarbaldehyde (PubChem CID 102169245) has the molecular formula C18H11BrClNO2 and a molecular weight of 388.65 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-chloro-3-phenylpyrrole-2,4-dicarbaldehyde.
| Compound Name | 1-(4-bromophenyl)-5-chloro-3-phenylpyrrole-2,4-dicarbaldehyde |
|---|---|
| PubChem CID | 102169245 |
| Molecular Formula | C18H11BrClNO2 |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 1-(4-bromophenyl)-5-chloro-3-phenylpyrrole-2,4-dicarbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2)c(C=O)n(-c2ccc(Br)cc2)c1Cl |
| InChI | InChI=1S/C18H11BrClNO2/c19-13-6-8-14(9-7-13)21-16(11-23)17(15(10-22)18(21)20)12-4-2-1-3-5-12/h1-11H |
| InChIKey | ZHRXAQHIIYMOOK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|