C47H76O5Si3 — CID 102185484
(2S,9S,10S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[tert-butyl(diphenyl)silyl]oxy-10-methyl-1-phenylmethoxyundecan-5-one (PubChem CID 102185484) has the molecular formula C47H76O5Si3 and a molecular weight of 805.38 g/mol. Its IUPAC name is (2S,9S,10S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[tert-butyl(diphenyl)silyl]oxy-10-methyl-1-phenylmethoxyundecan-5-one.
| Compound Name | (2S,9S,10S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[tert-butyl(diphenyl)silyl]oxy-10-methyl-1-phenylmethoxyundecan-5-one |
|---|---|
| PubChem CID | 102185484 |
| Molecular Formula | C47H76O5Si3 |
| Molecular Weight | 805.38 g/mol |
| Exact Mass | 804.50 |
| IUPAC Name | (2S,9S,10S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-[tert-butyl(diphenyl)silyl]oxy-10-methyl-1-phenylmethoxyundecan-5-one |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](CCCC(=O)CC[C@@H](COCc1ccccc1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C47H76O5Si3/c1-38(35-50-55(47(8,9)10,42-28-20-16-21-29-42)43-30-22-17-23-31-43)44(52-54(13,14)46(5,6)7)32-24-27-40(48)33-34-41(51-53(11,12)45(2,3)4)37-49-36-39-25-18-15-19-26-39/h15-23,25-26,28-31,38,41,44H,24,27,32-37H2,1-14H3/t38-,41-,44-/m0/s1 |
| InChIKey | UUIJXZYDVMDICG-KFLLSROBSA-N |
| XLogP | 11.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.38 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|