C41H52O5Si — CID 102185487
tert-butyl-[(2S)-2-[(2S,5S,7S)-2-[(2S,3S)-3-methyl-3-(4-phenylmethoxybut-2-ynyl)oxiran-2-yl]-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]-diphenylsilane (PubChem CID 102185487) has the molecular formula C41H52O5Si and a molecular weight of 652.95 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(2S,5S,7S)-2-[(2S,3S)-3-methyl-3-(4-phenylmethoxybut-2-ynyl)oxiran-2-yl]-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(2S,5S,7S)-2-[(2S,3S)-3-methyl-3-(4-phenylmethoxybut-2-ynyl)oxiran-2-yl]-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102185487 |
| Molecular Formula | C41H52O5Si |
| Molecular Weight | 652.95 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | tert-butyl-[(2S)-2-[(2S,5S,7S)-2-[(2S,3S)-3-methyl-3-(4-phenylmethoxybut-2-ynyl)oxiran-2-yl]-1,6-dioxaspiro[4.5]decan-7-yl]propoxy]-diphenylsilane |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCC[C@]2(CC[C@@H]([C@@H]3O[C@@]3(C)CC#CCOCc3ccccc3)O2)O1 |
| InChI | InChI=1S/C41H52O5Si/c1-32(30-43-47(39(2,3)4,34-20-11-7-12-21-34)35-22-13-8-14-23-35)36-24-17-27-41(44-36)28-25-37(45-41)38-40(5,46-38)26-15-16-29-42-31-33-18-9-6-10-19-33/h6-14,18-23,32,36-38H,17,24-31H2,1-5H3/t32-,36-,37-,38-,40-,41-/m0/s1 |
| InChIKey | PQOBYIXZUAFFFR-KAURGSMTSA-N |
| XLogP | 7.41 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.95 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|