C21H20O7 — CID 102251274
2-[(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)methyl]-5-methoxy-3-propanoylnaphthalene-1,4-dione (PubChem CID 102251274) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)methyl]-5-methoxy-3-propanoylnaphthalene-1,4-dione.
| Compound Name | 2-[(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)methyl]-5-methoxy-3-propanoylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 102251274 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)methyl]-5-methoxy-3-propanoylnaphthalene-1,4-dione |
| SMILES | CCC(=O)C1=C(CC2=CC(=O)OC(C)(C)O2)C(=O)c2cccc(OC)c2C1=O |
| InChI | InChI=1S/C21H20O7/c1-5-14(22)17-13(9-11-10-16(23)28-21(2,3)27-11)19(24)12-7-6-8-15(26-4)18(12)20(17)25/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | ASHOJULOZJOILO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|