C39H33N4NaO7S — CID 102269071
sodium N-[[3-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-(benzamidomethyl)-2,4,6-trimethylphenyl]methyl]benzenecarboximidate (PubChem CID 102269071) has the molecular formula C39H33N4NaO7S and a molecular weight of 724.77 g/mol. Its IUPAC name is sodium N-[[3-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-(benzamidomethyl)-2,4,6-trimethylphenyl]methyl]benzenecarboximidate.
| Compound Name | sodium N-[[3-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-(benzamidomethyl)-2,4,6-trimethylphenyl]methyl]benzenecarboximidate |
|---|---|
| PubChem CID | 102269071 |
| Molecular Formula | C39H33N4NaO7S |
| Molecular Weight | 724.77 g/mol |
| Exact Mass | 724.20 |
| IUPAC Name | sodium N-[[3-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-(benzamidomethyl)-2,4,6-trimethylphenyl]methyl]benzenecarboximidate |
| SMILES | Cc1c(C/N=C(\[O-])c2ccccc2)c(C)c(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c(C)c1CNC(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C39H34N4O7S.Na/c1-21-28(19-41-38(46)24-12-6-4-7-13-24)22(2)35(23(3)29(21)20-42-39(47)25-14-8-5-9-15-25)43-30-18-31(51(48,49)50)34(40)33-32(30)36(44)26-16-10-11-17-27(26)37(33)45;/h4-18,43H,19-20,40H2,1-3H3,(H,41,46)(H,42,47)(H,48,49,50);/q;+1/p-1 |
| InChIKey | QCTYVVWNINGBCP-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|