C23H20N6O5S — CID 129140903
1-amino-4-[3-amino-2-(azidomethyl)-4,6-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 129140903) has the molecular formula C23H20N6O5S and a molecular weight of 492.52 g/mol. Its IUPAC name is 1-amino-4-[3-amino-2-(azidomethyl)-4,6-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[3-amino-2-(azidomethyl)-4,6-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 129140903 |
| Molecular Formula | C23H20N6O5S |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 1-amino-4-[3-amino-2-(azidomethyl)-4,6-dimethylanilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Cc1cc(C)c(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c(CN=[N+]=[N-])c1N |
| InChI | InChI=1S/C23H20N6O5S/c1-10-7-11(2)21(14(19(10)24)9-27-29-26)28-15-8-16(35(32,33)34)20(25)18-17(15)22(30)12-5-3-4-6-13(12)23(18)31/h3-8,28H,9,24-25H2,1-2H3,(H,32,33,34) |
| InChIKey | ZAYARMRTTXQAMY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 201.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|