C28H25NO3 — CID 102295533
3-benzhydrylidene-2-(4-nitrophenyl)-6,7,8,8a-tetrahydro-5H-cyclohepta[b]furan (PubChem CID 102295533) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-benzhydrylidene-2-(4-nitrophenyl)-6,7,8,8a-tetrahydro-5H-cyclohepta[b]furan.
| Compound Name | 3-benzhydrylidene-2-(4-nitrophenyl)-6,7,8,8a-tetrahydro-5H-cyclohepta[b]furan |
|---|---|
| PubChem CID | 102295533 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-benzhydrylidene-2-(4-nitrophenyl)-6,7,8,8a-tetrahydro-5H-cyclohepta[b]furan |
| SMILES | O=[N+]([O-])c1ccc(C2OC3CCCCC=C3C2=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO3/c30-29(31)23-18-16-22(17-19-23)28-27(24-14-8-3-9-15-25(24)32-28)26(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-2,4-7,10-14,16-19,25,28H,3,8-9,15H2 |
| InChIKey | SBJLOHNOXZLZJM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|