C15H22N+ — CID 102347300
(6R,8aR)-4-methyl-6-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium (PubChem CID 102347300) has the molecular formula C15H22N+ and a molecular weight of 216.35 g/mol. Its IUPAC name is (6R,8aR)-4-methyl-6-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium.
| Compound Name | (6R,8aR)-4-methyl-6-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium |
|---|---|
| PubChem CID | 102347300 |
| Molecular Formula | C15H22N+ |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (6R,8aR)-4-methyl-6-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium |
| SMILES | C[N+]12CCC[C@H]1CC[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C15H22N/c1-16-11-5-8-15(16)10-9-14(12-16)13-6-3-2-4-7-13/h2-4,6-7,14-15H,5,8-12H2,1H3/q+1/t14-,15-,16?/m0/s1 |
| InChIKey | JSXNTQZHJWVZHU-KSCSMHSMSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|