C33H32N2O2 — CID 102380262
(R)-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-phenylmethanol (PubChem CID 102380262) has the molecular formula C33H32N2O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is (R)-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 102380262 |
| Molecular Formula | C33H32N2O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (R)-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-phenylmethanol |
| SMILES | CC1(C)COC([C@@H]2[C@H]([C@H](O)c3ccccc3)N2C(c2ccccc2)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C33H32N2O2/c1-32(2)23-37-31(34-32)29-28(30(36)24-15-7-3-8-16-24)35(29)33(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-22,28-30,36H,23H2,1-2H3/t28-,29+,30-,35?/m1/s1 |
| InChIKey | OWTDGQNCOYKQEA-YGHQCLQSSA-N |
| XLogP | 5.97 |
| TPSA | 44.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|