C26H42O4Si2 — CID 102411113
(1S,8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol (PubChem CID 102411113) has the molecular formula C26H42O4Si2 and a molecular weight of 474.79 g/mol. Its IUPAC name is (1S,8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol.
| Compound Name | (1S,8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol |
|---|---|
| PubChem CID | 102411113 |
| Molecular Formula | C26H42O4Si2 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (1S,8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C2C#C/C=C/COCC#CC[C@@]2(O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O4Si2/c1-24(2,3)31(7,8)29-22-20-21-16-12-11-14-18-28-19-15-13-17-26(21,27)23(22)30-32(9,10)25(4,5)6/h11,14,20,22-23,27H,17-19H2,1-10H3/b14-11+/t22-,23+,26+/m1/s1 |
| InChIKey | KLHPKEBFSMAPRV-MGLYLBQASA-N |
| XLogP | 5.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|