C24H48O5Si — CID 102447026
(3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylheptanal (PubChem CID 102447026) has the molecular formula C24H48O5Si and a molecular weight of 444.73 g/mol. Its IUPAC name is (3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylheptanal.
| Compound Name | (3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylheptanal |
|---|---|
| PubChem CID | 102447026 |
| Molecular Formula | C24H48O5Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | (3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]-4-methoxy-3,5-dimethylheptanal |
| SMILES | CC[C@@H]1COC(C)(C)O[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)[C@@H](C)CC=O |
| InChI | InChI=1S/C24H48O5Si/c1-12-19-16-27-24(7,8)28-21(19)15-20(29-30(10,11)23(4,5)6)18(3)22(26-9)17(2)13-14-25/h14,17-22H,12-13,15-16H2,1-11H3/t17-,18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | IJGQUHQDLSAILL-IUVRRTPNSA-N |
| XLogP | 5.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|