C21H16O3 — CID 10245216
(3aS,4S,8bS)-3a,4-diphenyl-4,8b-dihydroindeno[1,2-d]trioxole (PubChem CID 10245216) has the molecular formula C21H16O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (3aS,4S,8bS)-3a,4-diphenyl-4,8b-dihydroindeno[1,2-d]trioxole.
| Compound Name | (3aS,4S,8bS)-3a,4-diphenyl-4,8b-dihydroindeno[1,2-d]trioxole |
|---|---|
| PubChem CID | 10245216 |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (3aS,4S,8bS)-3a,4-diphenyl-4,8b-dihydroindeno[1,2-d]trioxole |
| SMILES | c1ccc([C@H]2c3ccccc3[C@@H]3OOO[C@]23c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16O3/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-21(19,23-24-22-20)16-11-5-2-6-12-16/h1-14,19-20H/t19-,20-,21+/m0/s1 |
| InChIKey | GYZJLWUBOFAVJQ-PCCBWWKXSA-N |
| XLogP | 4.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|