C25H30Br2OSi — CID 10324922
tert-butyl-[3-(2,2-dibromoethenyl)-4-(trideuteriomethyl)cyclohex-3-en-1-yl]oxy-diphenylsilane (PubChem CID 10324922) has the molecular formula C25H30Br2OSi and a molecular weight of 537.43 g/mol. Its IUPAC name is tert-butyl-[3-(2,2-dibromoethenyl)-4-(trideuteriomethyl)cyclohex-3-en-1-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[3-(2,2-dibromoethenyl)-4-(trideuteriomethyl)cyclohex-3-en-1-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10324922 |
| Molecular Formula | C25H30Br2OSi |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | tert-butyl-[3-(2,2-dibromoethenyl)-4-(trideuteriomethyl)cyclohex-3-en-1-yl]oxy-diphenylsilane |
| SMILES | [2H]C([2H])([2H])C1=C(C=C(Br)Br)CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H30Br2OSi/c1-19-15-16-21(17-20(19)18-24(26)27)28-29(25(2,3)4,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-14,18,21H,15-17H2,1-4H3/i1D3 |
| InChIKey | NPFOQHSFJAFASC-FIBGUPNXSA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|