C31H40N2O4Si — CID 159224445
tert-butyl-diphenyl-(4,5,6,7-tetrahydro-1,2-benzoxazol-6-yloxy)silane;methane;4,5,6,7-tetrahydro-1,2-benzoxazol-6-ol (PubChem CID 159224445) has the molecular formula C31H40N2O4Si and a molecular weight of 532.76 g/mol. Its IUPAC name is tert-butyl-diphenyl-(4,5,6,7-tetrahydro-1,2-benzoxazol-6-yloxy)silane;methane;4,5,6,7-tetrahydro-1,2-benzoxazol-6-ol.
| Compound Name | tert-butyl-diphenyl-(4,5,6,7-tetrahydro-1,2-benzoxazol-6-yloxy)silane;methane;4,5,6,7-tetrahydro-1,2-benzoxazol-6-ol |
|---|---|
| PubChem CID | 159224445 |
| Molecular Formula | C31H40N2O4Si |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | tert-butyl-diphenyl-(4,5,6,7-tetrahydro-1,2-benzoxazol-6-yloxy)silane;methane;4,5,6,7-tetrahydro-1,2-benzoxazol-6-ol |
| SMILES | C.CC(C)(C)[Si](OC1CCc2cnoc2C1)(c1ccccc1)c1ccccc1.OC1CCc2cnoc2C1 |
| InChI | InChI=1S/C23H27NO2Si.C7H9NO2.CH4/c1-23(2,3)27(20-10-6-4-7-11-20,21-12-8-5-9-13-21)26-19-15-14-18-17-24-25-22(18)16-19;9-6-2-1-5-4-8-10-7(5)3-6;/h4-13,17,19H,14-16H2,1-3H3;4,6,9H,1-3H2;1H4 |
| InChIKey | KSCMKWMXBOKHDN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|