C9H17N3OS — CID 103364815
5-N-(3-propoxypropyl)-1,2-thiazole-3,5-diamine (PubChem CID 103364815) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-N-(3-propoxypropyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(3-propoxypropyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103364815 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-N-(3-propoxypropyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCCOCCCNc1cc(N)ns1 |
| InChI | InChI=1S/C9H17N3OS/c1-2-5-13-6-3-4-11-9-7-8(10)12-14-9/h7,11H,2-6H2,1H3,(H2,10,12) |
| InChIKey | PXKFMPOVLNKXHJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|