C17H20F2N4O4S — CID 10364457
O-propyl N-[[(5R)-3-[3,5-difluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 10364457) has the molecular formula C17H20F2N4O4S and a molecular weight of 414.43 g/mol. Its IUPAC name is O-propyl N-[[(5R)-3-[3,5-difluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | O-propyl N-[[(5R)-3-[3,5-difluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 10364457 |
| Molecular Formula | C17H20F2N4O4S |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | O-propyl N-[[(5R)-3-[3,5-difluoro-4-(4-oxoimidazolidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | CCCOC(=S)NC[C@@H]1CN(c2cc(F)c(N3CNC(=O)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H20F2N4O4S/c1-2-3-26-16(28)20-6-11-7-23(17(25)27-11)10-4-12(18)15(13(19)5-10)22-8-14(24)21-9-22/h4-5,11H,2-3,6-9H2,1H3,(H,20,28)(H,21,24)/t11-/m1/s1 |
| InChIKey | FFPMXTYYJRLDGW-LLVKDONJSA-N |
| XLogP | 1.48 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|